C22H34O5Si — CID 11732265
2-[(2R,4aR,6S,7R,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-phenyl-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-yl]acetaldehyde (PubChem CID 11732265) has the molecular formula C22H34O5Si and a molecular weight of 406.60 g/mol. Its IUPAC name is 2-[(2R,4aR,6S,7R,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-phenyl-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-yl]acetaldehyde.
| Compound Name | 2-[(2R,4aR,6S,7R,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-phenyl-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 11732265 |
| Molecular Formula | C22H34O5Si |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 2-[(2R,4aR,6S,7R,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-2-phenyl-4a,7,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-6-yl]acetaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2O[C@H](c3ccccc3)OC[C@H]2O[C@@]1(C)CC=O |
| InChI | InChI=1S/C22H34O5Si/c1-21(2,3)28(5,6)27-19-14-17-18(26-22(19,4)12-13-23)15-24-20(25-17)16-10-8-7-9-11-16/h7-11,13,17-20H,12,14-15H2,1-6H3/t17-,18+,19+,20+,22-/m0/s1 |
| InChIKey | BVODEICHCGVFPT-RHFRXIPYSA-N |
| XLogP | 4.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|