C21H32O5Si — CID 11036619
(2R,4aR,6S,9aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenyl-4a,8,9,9a-tetrahydro-4H-[1,3]dioxino[5,4-b]oxepin-7-one (PubChem CID 11036619) has the molecular formula C21H32O5Si and a molecular weight of 392.57 g/mol. Its IUPAC name is (2R,4aR,6S,9aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenyl-4a,8,9,9a-tetrahydro-4H-[1,3]dioxino[5,4-b]oxepin-7-one.
| Compound Name | (2R,4aR,6S,9aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenyl-4a,8,9,9a-tetrahydro-4H-[1,3]dioxino[5,4-b]oxepin-7-one |
|---|---|
| PubChem CID | 11036619 |
| Molecular Formula | C21H32O5Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (2R,4aR,6S,9aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-phenyl-4a,8,9,9a-tetrahydro-4H-[1,3]dioxino[5,4-b]oxepin-7-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2CCC1=O |
| InChI | InChI=1S/C21H32O5Si/c1-21(2,3)27(4,5)24-14-18-16(22)11-12-17-19(25-18)13-23-20(26-17)15-9-7-6-8-10-15/h6-10,17-20H,11-14H2,1-5H3/t17-,18-,19+,20+/m0/s1 |
| InChIKey | YWJVRTWTMLOFBO-VNTMZGSJSA-N |
| XLogP | 4.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|