C16H18O5 — CID 11185375
(1R,3S,7R,10S,12R)-12-phenyl-2,6,11,13-tetraoxatricyclo[8.4.0.03,7]tetradecan-5-one (PubChem CID 11185375) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is (1R,3S,7R,10S,12R)-12-phenyl-2,6,11,13-tetraoxatricyclo[8.4.0.03,7]tetradecan-5-one.
| Compound Name | (1R,3S,7R,10S,12R)-12-phenyl-2,6,11,13-tetraoxatricyclo[8.4.0.03,7]tetradecan-5-one |
|---|---|
| PubChem CID | 11185375 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (1R,3S,7R,10S,12R)-12-phenyl-2,6,11,13-tetraoxatricyclo[8.4.0.03,7]tetradecan-5-one |
| SMILES | O=C1C[C@@H]2O[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3CC[C@H]2O1 |
| InChI | InChI=1S/C16H18O5/c17-15-8-13-11(20-15)6-7-12-14(19-13)9-18-16(21-12)10-4-2-1-3-5-10/h1-5,11-14,16H,6-9H2/t11-,12+,13+,14-,16-/m1/s1 |
| InChIKey | FZAHKKWTAPSJFD-WZYWGQKZSA-N |
| XLogP | 1.96 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |