C19H19NO5 — CID 7309579
(2R,4aR,8aS)-7-(3-oxocyclohexen-1-yl)imino-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-one (PubChem CID 7309579) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is (2R,4aR,8aS)-7-(3-oxocyclohexen-1-yl)imino-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-one.
| Compound Name | (2R,4aR,8aS)-7-(3-oxocyclohexen-1-yl)imino-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-one |
|---|---|
| PubChem CID | 7309579 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (2R,4aR,8aS)-7-(3-oxocyclohexen-1-yl)imino-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-6-one |
| SMILES | O=C1C=C(/N=C2\C[C@@H]3O[C@H](c4ccccc4)OC[C@H]3OC2=O)CCC1 |
| InChI | InChI=1S/C19H19NO5/c21-14-8-4-7-13(9-14)20-15-10-16-17(24-18(15)22)11-23-19(25-16)12-5-2-1-3-6-12/h1-3,5-6,9,16-17,19H,4,7-8,10-11H2/b20-15+/t16-,17+,19+/m0/s1 |
| InChIKey | DOORUHZNLBYANJ-OGPNIPJXSA-N |
| XLogP | 2.49 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|