C16H20O5 — CID 102113579
(2S,3R)-3-[[(2R,4S,5R)-5-hydroxy-5-methyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-methyloxirane-2-carbaldehyde (PubChem CID 102113579) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (2S,3R)-3-[[(2R,4S,5R)-5-hydroxy-5-methyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-methyloxirane-2-carbaldehyde.
| Compound Name | (2S,3R)-3-[[(2R,4S,5R)-5-hydroxy-5-methyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-methyloxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 102113579 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (2S,3R)-3-[[(2R,4S,5R)-5-hydroxy-5-methyl-2-phenyl-1,3-dioxan-4-yl]methyl]-2-methyloxirane-2-carbaldehyde |
| SMILES | C[C@]1(C=O)O[C@@H]1C[C@@H]1O[C@H](c2ccccc2)OC[C@@]1(C)O |
| InChI | InChI=1S/C16H20O5/c1-15(18)10-19-14(11-6-4-3-5-7-11)20-12(15)8-13-16(2,9-17)21-13/h3-7,9,12-14,18H,8,10H2,1-2H3/t12-,13+,14+,15+,16+/m0/s1 |
| InChIKey | YRELOQCBYHWRSP-UYJHQMFVSA-N |
| XLogP | 1.60 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|