C19H25NO6 — CID 11199281
N-[(1S,2R,6S,7S,9S,12R)-9-hydroxy-4,4-dimethyl-12-phenyl-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-7-yl]acetamide (PubChem CID 11199281) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is N-[(1S,2R,6S,7S,9S,12R)-9-hydroxy-4,4-dimethyl-12-phenyl-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-7-yl]acetamide.
| Compound Name | N-[(1S,2R,6S,7S,9S,12R)-9-hydroxy-4,4-dimethyl-12-phenyl-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-7-yl]acetamide |
|---|---|
| PubChem CID | 11199281 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-[(1S,2R,6S,7S,9S,12R)-9-hydroxy-4,4-dimethyl-12-phenyl-3,5,11,13-tetraoxatricyclo[7.4.0.02,6]tridecan-7-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C[C@]2(O)CO[C@@H](c3ccccc3)O[C@H]2[C@@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C19H25NO6/c1-11(21)20-13-9-19(22)10-23-17(12-7-5-4-6-8-12)24-16(19)15-14(13)25-18(2,3)26-15/h4-8,13-17,22H,9-10H2,1-3H3,(H,20,21)/t13-,14-,15+,16-,17+,19-/m0/s1 |
| InChIKey | RTPOIBRCGCNEMB-JOSHXOIJSA-N |
| XLogP | 1.26 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |