C15H20O3 — CID 11470665
[(2S,4R,5R)-5-methyl-2-phenyl-4-prop-2-enyl-1,3-dioxan-5-yl]methanol (PubChem CID 11470665) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is [(2S,4R,5R)-5-methyl-2-phenyl-4-prop-2-enyl-1,3-dioxan-5-yl]methanol.
| Compound Name | [(2S,4R,5R)-5-methyl-2-phenyl-4-prop-2-enyl-1,3-dioxan-5-yl]methanol |
|---|---|
| PubChem CID | 11470665 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [(2S,4R,5R)-5-methyl-2-phenyl-4-prop-2-enyl-1,3-dioxan-5-yl]methanol |
| SMILES | C=CC[C@H]1O[C@@H](c2ccccc2)OC[C@@]1(C)CO |
| InChI | InChI=1S/C15H20O3/c1-3-7-13-15(2,10-16)11-17-14(18-13)12-8-5-4-6-9-12/h3-6,8-9,13-14,16H,1,7,10-11H2,2H3/t13-,14+,15-/m1/s1 |
| InChIKey | DOSOLRFWRGEUHN-QLFBSQMISA-N |
| XLogP | 2.68 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|