About 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane
4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane (PubChem CID 68896314) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane.
Molecular Properties
| Compound Name | 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane |
| PubChem CID | 68896314 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane |
| SMILES | C=CC1OC(c2ccccc2)OCC1(C)C |
| InChI | InChI=1S/C14H18O2/c1-4-12-14(2,3)10-15-13(16-12)11-8-6-5-7-9-11/h4-9,12-13H,1,10H2,2-3H3 |
| InChIKey | QPJOKDHGAXVLFH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane?
The IUPAC name of 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane (CID 68896314) is 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane.
What is the SMILES notation for 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane?
The canonical SMILES for 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane is C=CC1OC(c2ccccc2)OCC1(C)C.
What is the InChIKey of 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane?
The InChIKey is QPJOKDHGAXVLFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O2/c1-4-12-14(2,3)10-15-13(16-12)11-8-6-5-7-9-11/h4-9,12-13H,1,10H2,2-3H3.
What are the key properties of 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane?
4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane has a molecular weight of 218.30 g/mol, XLogP of 3.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-5,5-dimethyl-2-phenyl-1,3-dioxane is sourced from PubChem (CID 68896314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).