C17H22O5 — CID 10335299
(1S,2S,4R,6S,9R,12R)-4-ethoxy-12-phenyl-3,8,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane (PubChem CID 10335299) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (1S,2S,4R,6S,9R,12R)-4-ethoxy-12-phenyl-3,8,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1S,2S,4R,6S,9R,12R)-4-ethoxy-12-phenyl-3,8,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 10335299 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (1S,2S,4R,6S,9R,12R)-4-ethoxy-12-phenyl-3,8,11,13-tetraoxatricyclo[7.4.0.02,6]tridecane |
| SMILES | CCO[C@H]1C[C@H]2CO[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C17H22O5/c1-2-18-14-8-12-9-19-13-10-20-17(11-6-4-3-5-7-11)22-16(13)15(12)21-14/h3-7,12-17H,2,8-10H2,1H3/t12-,13+,14+,15-,16+,17+/m0/s1 |
| InChIKey | IQKNLPJGYROCEQ-JXMXSTLTSA-N |
| XLogP | 2.27 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |