C18H19NO6 — CID 25193759
ethyl 3-formyl-4-[(2R,4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]-1H-pyrrole-2-carboxylate (PubChem CID 25193759) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is ethyl 3-formyl-4-[(2R,4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 3-formyl-4-[(2R,4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 25193759 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | ethyl 3-formyl-4-[(2R,4S,5R)-5-hydroxy-2-phenyl-1,3-dioxan-4-yl]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]cc([C@@H]2O[C@H](c3ccccc3)OC[C@H]2O)c1C=O |
| InChI | InChI=1S/C18H19NO6/c1-2-23-17(22)15-13(9-20)12(8-19-15)16-14(21)10-24-18(25-16)11-6-4-3-5-7-11/h3-9,14,16,18-19,21H,2,10H2,1H3/t14-,16+,18-/m1/s1 |
| InChIKey | FAHHYEMHAGSLQE-UWWQBHOKSA-N |
| XLogP | 2.15 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|