C19H21NO6 — CID 25193554
ethyl (1S,7S,9R,12R)-7-methoxy-12-phenyl-8,11,13-trioxa-4-azatricyclo[7.4.0.02,6]trideca-2,5-diene-5-carboxylate (PubChem CID 25193554) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is ethyl (1S,7S,9R,12R)-7-methoxy-12-phenyl-8,11,13-trioxa-4-azatricyclo[7.4.0.02,6]trideca-2,5-diene-5-carboxylate.
| Compound Name | ethyl (1S,7S,9R,12R)-7-methoxy-12-phenyl-8,11,13-trioxa-4-azatricyclo[7.4.0.02,6]trideca-2,5-diene-5-carboxylate |
|---|---|
| PubChem CID | 25193554 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | ethyl (1S,7S,9R,12R)-7-methoxy-12-phenyl-8,11,13-trioxa-4-azatricyclo[7.4.0.02,6]trideca-2,5-diene-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]cc2c1[C@@H](OC)O[C@@H]1CO[C@@H](c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C19H21NO6/c1-3-23-17(21)15-14-12(9-20-15)16-13(25-19(14)22-2)10-24-18(26-16)11-7-5-4-6-8-11/h4-9,13,16,18-20H,3,10H2,1-2H3/t13-,16+,18-,19+/m1/s1 |
| InChIKey | OMJKTGHJELZKPV-HQJJXPTPSA-N |
| XLogP | 3.02 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |