C18H20N2O4 — CID 24770189
(1S,7S,9R,12R)-7-methoxy-12-phenyl-4-prop-2-enyl-8,11,13-trioxa-3,4-diazatricyclo[7.4.0.02,6]trideca-2,5-diene (PubChem CID 24770189) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is (1S,7S,9R,12R)-7-methoxy-12-phenyl-4-prop-2-enyl-8,11,13-trioxa-3,4-diazatricyclo[7.4.0.02,6]trideca-2,5-diene.
| Compound Name | (1S,7S,9R,12R)-7-methoxy-12-phenyl-4-prop-2-enyl-8,11,13-trioxa-3,4-diazatricyclo[7.4.0.02,6]trideca-2,5-diene |
|---|---|
| PubChem CID | 24770189 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (1S,7S,9R,12R)-7-methoxy-12-phenyl-4-prop-2-enyl-8,11,13-trioxa-3,4-diazatricyclo[7.4.0.02,6]trideca-2,5-diene |
| SMILES | C=CCn1cc2c(n1)[C@@H]1O[C@H](c3ccccc3)OC[C@H]1O[C@@H]2OC |
| InChI | InChI=1S/C18H20N2O4/c1-3-9-20-10-13-15(19-20)16-14(23-18(13)21-2)11-22-17(24-16)12-7-5-4-6-8-12/h3-8,10,14,16-18H,1,9,11H2,2H3/t14-,16-,17-,18+/m1/s1 |
| InChIKey | NKUJBPANDNZOIU-DDBAPUKQSA-N |
| XLogP | 2.90 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|