C21H22O5 — CID 101011075
(4aR,6S,8aS)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine (PubChem CID 101011075) has the molecular formula C21H22O5 and a molecular weight of 354.40 g/mol. Its IUPAC name is (4aR,6S,8aS)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (4aR,6S,8aS)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 101011075 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (4aR,6S,8aS)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2C=C1OCc1ccccc1 |
| InChI | InChI=1S/C21H22O5/c1-22-21-18(23-13-15-8-4-2-5-9-15)12-17-19(26-21)14-24-20(25-17)16-10-6-3-7-11-16/h2-12,17,19-21H,13-14H2,1H3/t17-,19+,20?,21-/m0/s1 |
| InChIKey | ZPGHYRCZZVKAGU-KITQWDANSA-N |
| XLogP | 3.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |