C15H16O5 — CID 14055354
(4aR,6S,8aS)-6-methoxy-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine-7-carbaldehyde (PubChem CID 14055354) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is (4aR,6S,8aS)-6-methoxy-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine-7-carbaldehyde.
| Compound Name | (4aR,6S,8aS)-6-methoxy-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine-7-carbaldehyde |
|---|---|
| PubChem CID | 14055354 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (4aR,6S,8aS)-6-methoxy-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxine-7-carbaldehyde |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2C=C1C=O |
| InChI | InChI=1S/C15H16O5/c1-17-14-11(8-16)7-12-13(20-14)9-18-15(19-12)10-5-3-2-4-6-10/h2-8,12-15H,9H2,1H3/t12-,13+,14-,15?/m0/s1 |
| InChIKey | YVIYRAUZFZICJP-MBOZISHXSA-N |
| XLogP | 1.60 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|