C16H17NO6 — CID 102378037
(4aR,6R,7R,8R,8aS)-8-formyl-7-hydroxy-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-8-carbonitrile (PubChem CID 102378037) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is (4aR,6R,7R,8R,8aS)-8-formyl-7-hydroxy-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-8-carbonitrile.
| Compound Name | (4aR,6R,7R,8R,8aS)-8-formyl-7-hydroxy-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-8-carbonitrile |
|---|---|
| PubChem CID | 102378037 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (4aR,6R,7R,8R,8aS)-8-formyl-7-hydroxy-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-8-carbonitrile |
| SMILES | CO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@](C#N)(C=O)[C@H]1O |
| InChI | InChI=1S/C16H17NO6/c1-20-15-12(19)16(8-17,9-18)13-11(22-15)7-21-14(23-13)10-5-3-2-4-6-10/h2-6,9,11-15,19H,7H2,1H3/t11-,12+,13-,14?,15-,16-/m1/s1 |
| InChIKey | MUXRKICFHYSGBY-IKQLZHDRSA-N |
| XLogP | 0.54 |
| TPSA | 98.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|