C16H19ClO6 — CID 11267893
(2R,4aR,6S,7R,8S,8aR)-3'-chloro-6,7-dimethoxy-2-phenylspiro[4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-8,2'-oxirane] (PubChem CID 11267893) has the molecular formula C16H19ClO6 and a molecular weight of 342.78 g/mol. Its IUPAC name is (2R,4aR,6S,7R,8S,8aR)-3'-chloro-6,7-dimethoxy-2-phenylspiro[4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-8,2'-oxirane].
| Compound Name | (2R,4aR,6S,7R,8S,8aR)-3'-chloro-6,7-dimethoxy-2-phenylspiro[4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-8,2'-oxirane] |
|---|---|
| PubChem CID | 11267893 |
| Molecular Formula | C16H19ClO6 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | (2R,4aR,6S,7R,8S,8aR)-3'-chloro-6,7-dimethoxy-2-phenylspiro[4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-8,2'-oxirane] |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@]2(OC2Cl)[C@H]1OC |
| InChI | InChI=1S/C16H19ClO6/c1-18-12-14(19-2)21-10-8-20-13(9-6-4-3-5-7-9)22-11(10)16(12)15(17)23-16/h3-7,10-15H,8H2,1-2H3/t10-,11-,12+,13-,14+,15?,16+/m1/s1 |
| InChIKey | SNVOMPJPIPZJMV-BMAMJUNYSA-N |
| XLogP | 1.82 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|