C17H23NO9S — CID 122699285
[(4aR,6S,7S,8R,8aR)-8-acetamido-8-hydroxy-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl] methanesulfonate (PubChem CID 122699285) has the molecular formula C17H23NO9S and a molecular weight of 417.44 g/mol. Its IUPAC name is [(4aR,6S,7S,8R,8aR)-8-acetamido-8-hydroxy-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl] methanesulfonate.
| Compound Name | [(4aR,6S,7S,8R,8aR)-8-acetamido-8-hydroxy-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 122699285 |
| Molecular Formula | C17H23NO9S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [(4aR,6S,7S,8R,8aR)-8-acetamido-8-hydroxy-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-7-yl] methanesulfonate |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@](O)(NC(C)=O)[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C17H23NO9S/c1-10(19)18-17(20)13-12(25-16(23-2)14(17)27-28(3,21)22)9-24-15(26-13)11-7-5-4-6-8-11/h4-8,12-16,20H,9H2,1-3H3,(H,18,19)/t12-,13-,14-,15?,16+,17-/m1/s1 |
| InChIKey | PQNCPEZGPIMUOR-JYMAHSKQSA-N |
| XLogP | -0.36 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|