C17H22O7 — CID 59012601
8-(ethoxymethoxy)-6-methoxy-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-one (PubChem CID 59012601) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is 8-(ethoxymethoxy)-6-methoxy-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-one.
| Compound Name | 8-(ethoxymethoxy)-6-methoxy-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-one |
|---|---|
| PubChem CID | 59012601 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 8-(ethoxymethoxy)-6-methoxy-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-7-one |
| SMILES | CCOCOC1C(=O)C(OC)OC2COC(c3ccccc3)OC21 |
| InChI | InChI=1S/C17H22O7/c1-3-20-10-22-15-13(18)17(19-2)23-12-9-21-16(24-14(12)15)11-7-5-4-6-8-11/h4-8,12,14-17H,3,9-10H2,1-2H3 |
| InChIKey | QGSJQUASUSDCST-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|