C20H26O5Si — CID 11047001
(E)-1-[(4aR,6S,8aS)-6-methoxy-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]-3-trimethylsilylprop-2-en-1-one (PubChem CID 11047001) has the molecular formula C20H26O5Si and a molecular weight of 374.51 g/mol. Its IUPAC name is (E)-1-[(4aR,6S,8aS)-6-methoxy-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]-3-trimethylsilylprop-2-en-1-one.
| Compound Name | (E)-1-[(4aR,6S,8aS)-6-methoxy-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]-3-trimethylsilylprop-2-en-1-one |
|---|---|
| PubChem CID | 11047001 |
| Molecular Formula | C20H26O5Si |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (E)-1-[(4aR,6S,8aS)-6-methoxy-2-phenyl-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-yl]-3-trimethylsilylprop-2-en-1-one |
| SMILES | CO[C@@H]1C=C(C(=O)/C=C/[Si](C)(C)C)[C@@H]2OC(c3ccccc3)OC[C@H]2O1 |
| InChI | InChI=1S/C20H26O5Si/c1-22-18-12-15(16(21)10-11-26(2,3)4)19-17(24-18)13-23-20(25-19)14-8-6-5-7-9-14/h5-12,17-20H,13H2,1-4H3/b11-10+/t17-,18+,19+,20?/m1/s1 |
| InChIKey | GWRLBHLVPAKOEG-DCGYVERTSA-N |
| XLogP | 3.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|