C19H24O6 — CID 10617701
(2S,4R,7R,9S)-12-ethoxy-9-methoxy-4-phenyl-3,5,8,11-tetraoxatricyclo[8.4.0.02,7]tetradec-1(10)-ene (PubChem CID 10617701) has the molecular formula C19H24O6 and a molecular weight of 348.39 g/mol. Its IUPAC name is (2S,4R,7R,9S)-12-ethoxy-9-methoxy-4-phenyl-3,5,8,11-tetraoxatricyclo[8.4.0.02,7]tetradec-1(10)-ene.
| Compound Name | (2S,4R,7R,9S)-12-ethoxy-9-methoxy-4-phenyl-3,5,8,11-tetraoxatricyclo[8.4.0.02,7]tetradec-1(10)-ene |
|---|---|
| PubChem CID | 10617701 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (2S,4R,7R,9S)-12-ethoxy-9-methoxy-4-phenyl-3,5,8,11-tetraoxatricyclo[8.4.0.02,7]tetradec-1(10)-ene |
| SMILES | CCOC1CCC2=C(O1)[C@@H](OC)O[C@@H]1CO[C@@H](c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C19H24O6/c1-3-21-15-10-9-13-16-14(23-19(20-2)17(13)24-15)11-22-18(25-16)12-7-5-4-6-8-12/h4-8,14-16,18-19H,3,9-11H2,1-2H3/t14-,15?,16+,18-,19+/m1/s1 |
| InChIKey | PHQIMVZFXDHAQS-LCKDPTFFSA-N |
| XLogP | 2.90 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |