C18H25NO4 — CID 101467180
(1S,2S,6R,7S,9R,12R)-3-ethyl-7-methoxy-12-phenyl-8,11,13-trioxa-3-azatricyclo[7.4.0.02,6]tridecane (PubChem CID 101467180) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is (1S,2S,6R,7S,9R,12R)-3-ethyl-7-methoxy-12-phenyl-8,11,13-trioxa-3-azatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1S,2S,6R,7S,9R,12R)-3-ethyl-7-methoxy-12-phenyl-8,11,13-trioxa-3-azatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 101467180 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | (1S,2S,6R,7S,9R,12R)-3-ethyl-7-methoxy-12-phenyl-8,11,13-trioxa-3-azatricyclo[7.4.0.02,6]tridecane |
| SMILES | CCN1CC[C@H]2[C@@H](OC)O[C@@H]3CO[C@@H](c4ccccc4)O[C@H]3[C@H]21 |
| InChI | InChI=1S/C18H25NO4/c1-3-19-10-9-13-15(19)16-14(22-18(13)20-2)11-21-17(23-16)12-7-5-4-6-8-12/h4-8,13-18H,3,9-11H2,1-2H3/t13-,14-,15+,16-,17-,18+/m1/s1 |
| InChIKey | LWOILRSYVKNSRH-PNVOZDDCSA-N |
| XLogP | 2.18 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |