C19H27NO4 — CID 101369189
(1S,2R,6S,7S,9R,12R)-7-methoxy-12-phenyl-5-propan-2-yl-8,11,13-trioxa-5-azatricyclo[7.4.0.02,6]tridecane (PubChem CID 101369189) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (1S,2R,6S,7S,9R,12R)-7-methoxy-12-phenyl-5-propan-2-yl-8,11,13-trioxa-5-azatricyclo[7.4.0.02,6]tridecane.
| Compound Name | (1S,2R,6S,7S,9R,12R)-7-methoxy-12-phenyl-5-propan-2-yl-8,11,13-trioxa-5-azatricyclo[7.4.0.02,6]tridecane |
|---|---|
| PubChem CID | 101369189 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (1S,2R,6S,7S,9R,12R)-7-methoxy-12-phenyl-5-propan-2-yl-8,11,13-trioxa-5-azatricyclo[7.4.0.02,6]tridecane |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]2CCN(C(C)C)[C@H]12 |
| InChI | InChI=1S/C19H27NO4/c1-12(2)20-10-9-14-16(20)19(21-3)23-15-11-22-18(24-17(14)15)13-7-5-4-6-8-13/h4-8,12,14-19H,9-11H2,1-3H3/t14-,15-,16+,17+,18-,19+/m1/s1 |
| InChIKey | NKSUFPFXBZGHIG-NYLIBXOJSA-N |
| XLogP | 2.57 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |