C20H18N2O5 — CID 102035920
(2S,4R,7R,9S)-13-(furan-2-yl)-9-methoxy-4-phenyl-3,5,8-trioxa-12,14-diazatricyclo[8.4.0.02,7]tetradeca-1(14),10,12-triene (PubChem CID 102035920) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is (2S,4R,7R,9S)-13-(furan-2-yl)-9-methoxy-4-phenyl-3,5,8-trioxa-12,14-diazatricyclo[8.4.0.02,7]tetradeca-1(14),10,12-triene.
| Compound Name | (2S,4R,7R,9S)-13-(furan-2-yl)-9-methoxy-4-phenyl-3,5,8-trioxa-12,14-diazatricyclo[8.4.0.02,7]tetradeca-1(14),10,12-triene |
|---|---|
| PubChem CID | 102035920 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2S,4R,7R,9S)-13-(furan-2-yl)-9-methoxy-4-phenyl-3,5,8-trioxa-12,14-diazatricyclo[8.4.0.02,7]tetradeca-1(14),10,12-triene |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2c2nc(-c3ccco3)ncc21 |
| InChI | InChI=1S/C20H18N2O5/c1-23-20-13-10-21-18(14-8-5-9-24-14)22-16(13)17-15(26-20)11-25-19(27-17)12-6-3-2-4-7-12/h2-10,15,17,19-20H,11H2,1H3/t15-,17-,19-,20+/m1/s1 |
| InChIKey | GFBWFCFLBGHLPW-QOJCHSLYSA-N |
| XLogP | 3.57 |
| TPSA | 75.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |