C19H22N2O5 — CID 101232906
ethyl 2-[(4aR,6S,7S,7aS)-6-imidazol-1-yl-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl]acetate (PubChem CID 101232906) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is ethyl 2-[(4aR,6S,7S,7aS)-6-imidazol-1-yl-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl]acetate.
| Compound Name | ethyl 2-[(4aR,6S,7S,7aS)-6-imidazol-1-yl-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl]acetate |
|---|---|
| PubChem CID | 101232906 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | ethyl 2-[(4aR,6S,7S,7aS)-6-imidazol-1-yl-2-phenyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@@H]2OC(c3ccccc3)OC[C@H]2O[C@@H]1n1ccnc1 |
| InChI | InChI=1S/C19H22N2O5/c1-2-23-16(22)10-14-17-15(25-18(14)21-9-8-20-12-21)11-24-19(26-17)13-6-4-3-5-7-13/h3-9,12,14-15,17-19H,2,10-11H2,1H3/t14-,15+,17-,18-,19?/m0/s1 |
| InChIKey | NEVABLMVTOAEEH-FFZZFDENSA-N |
| XLogP | 2.46 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |