C24H21N3O3 — CID 166637036
(1S,10S)-13-hydroxy-13-(4-methylphenyl)-6-phenyl-4,6,8-triazahexacyclo[7.5.0.02,14.03,11.04,8.010,12]tetradecane-5,7-dione (PubChem CID 166637036) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is (1S,10S)-13-hydroxy-13-(4-methylphenyl)-6-phenyl-4,6,8-triazahexacyclo[7.5.0.02,14.03,11.04,8.010,12]tetradecane-5,7-dione.
| Compound Name | (1S,10S)-13-hydroxy-13-(4-methylphenyl)-6-phenyl-4,6,8-triazahexacyclo[7.5.0.02,14.03,11.04,8.010,12]tetradecane-5,7-dione |
|---|---|
| PubChem CID | 166637036 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (1S,10S)-13-hydroxy-13-(4-methylphenyl)-6-phenyl-4,6,8-triazahexacyclo[7.5.0.02,14.03,11.04,8.010,12]tetradecane-5,7-dione |
| SMILES | Cc1ccc(C2(O)C3C4C5C6C2[C@H]6C([C@@H]43)n2c(=O)n(-c3ccccc3)c(=O)n25)cc1 |
| InChI | InChI=1S/C24H21N3O3/c1-11-7-9-12(10-8-11)24(30)18-14-15(18)21-17-16(19(17)24)20(14)26-22(28)25(23(29)27(21)26)13-5-3-2-4-6-13/h2-10,14-21,30H,1H3/t14-,15?,16-,17?,18?,19?,20?,21?,24?/m0/s1 |
| InChIKey | IBTWWSIIYATYFM-RFHANGEISA-N |
| XLogP | 1.84 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |