C17H12N4O2 — CID 94037193
(1R,7S,8S,11S)-3,5-dioxo-4-phenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-1-carbonitrile (PubChem CID 94037193) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is (1R,7S,8S,11S)-3,5-dioxo-4-phenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-1-carbonitrile.
| Compound Name | (1R,7S,8S,11S)-3,5-dioxo-4-phenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-1-carbonitrile |
|---|---|
| PubChem CID | 94037193 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (1R,7S,8S,11S)-3,5-dioxo-4-phenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-1-carbonitrile |
| SMILES | N#C[C@@]12C=C[C@@H]([C@H]3C=C[C@@H]31)n1c(=O)n(-c3ccccc3)c(=O)n12 |
| InChI | InChI=1S/C17H12N4O2/c18-10-17-9-8-14(12-6-7-13(12)17)20-15(22)19(16(23)21(17)20)11-4-2-1-3-5-11/h1-9,12-14H/t12-,13-,14-,17-/m0/s1 |
| InChIKey | WREBPHQLKCHKIM-WSMBLCCSSA-N |
| XLogP | 0.95 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|