C20H21N3O3 — CID 98556111
(1S,2S,3R,5R,6S,7S)-1,2,3,5-tetramethyl-10-phenyl-4-oxa-8,10,12-triazapentacyclo[5.5.2.02,6.03,5.08,12]tetradec-13-ene-9,11-dione (PubChem CID 98556111) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (1S,2S,3R,5R,6S,7S)-1,2,3,5-tetramethyl-10-phenyl-4-oxa-8,10,12-triazapentacyclo[5.5.2.02,6.03,5.08,12]tetradec-13-ene-9,11-dione.
| Compound Name | (1S,2S,3R,5R,6S,7S)-1,2,3,5-tetramethyl-10-phenyl-4-oxa-8,10,12-triazapentacyclo[5.5.2.02,6.03,5.08,12]tetradec-13-ene-9,11-dione |
|---|---|
| PubChem CID | 98556111 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (1S,2S,3R,5R,6S,7S)-1,2,3,5-tetramethyl-10-phenyl-4-oxa-8,10,12-triazapentacyclo[5.5.2.02,6.03,5.08,12]tetradec-13-ene-9,11-dione |
| SMILES | C[C@]12O[C@]1(C)[C@@H]1[C@@H]3C=C[C@](C)(n4c(=O)n(-c5ccccc5)c(=O)n43)[C@]12C |
| InChI | InChI=1S/C20H21N3O3/c1-17-11-10-13(14-18(17,2)20(4)19(14,3)26-20)22-15(24)21(16(25)23(17)22)12-8-6-5-7-9-12/h5-11,13-14H,1-4H3/t13-,14+,17-,18-,19+,20+/m0/s1 |
| InChIKey | QISZJRBZRTYOQY-AFVQWYAQSA-N |
| XLogP | 1.82 |
| TPSA | 61.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|