C14H8Cl5N3O2 — CID 10550416
(1S,7R)-1,7,8,9,10-pentachloro-10-methyl-4-phenyl-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 10550416) has the molecular formula C14H8Cl5N3O2 and a molecular weight of 427.50 g/mol. Its IUPAC name is (1S,7R)-1,7,8,9,10-pentachloro-10-methyl-4-phenyl-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,7R)-1,7,8,9,10-pentachloro-10-methyl-4-phenyl-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 10550416 |
| Molecular Formula | C14H8Cl5N3O2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 424.91 |
| IUPAC Name | (1S,7R)-1,7,8,9,10-pentachloro-10-methyl-4-phenyl-2,4,6-triazatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC1(Cl)[C@@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)n1c(=O)n(-c3ccccc3)c(=O)n12 |
| InChI | InChI=1S/C14H8Cl5N3O2/c1-12(17)13(18)8(15)9(16)14(12,19)22-11(24)20(10(23)21(13)22)7-5-3-2-4-6-7/h2-6H,1H3/t12?,13-,14+ |
| InChIKey | APVVICXMXZSGSY-AGUYFDCRSA-N |
| XLogP | 3.30 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|