C16H12BrN3O2 — CID 94037190
(1S,7R,8S,11R)-12-bromo-4-phenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione (PubChem CID 94037190) has the molecular formula C16H12BrN3O2 and a molecular weight of 358.20 g/mol. Its IUPAC name is (1S,7R,8S,11R)-12-bromo-4-phenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione.
| Compound Name | (1S,7R,8S,11R)-12-bromo-4-phenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
|---|---|
| PubChem CID | 94037190 |
| Molecular Formula | C16H12BrN3O2 |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | (1S,7R,8S,11R)-12-bromo-4-phenyl-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]trideca-9,12-diene-3,5-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1[C@@H]1C(Br)=C[C@H]2[C@H]2C=C[C@H]21 |
| InChI | InChI=1S/C16H12BrN3O2/c17-12-8-13-10-6-7-11(10)14(12)20-16(22)18(15(21)19(13)20)9-4-2-1-3-5-9/h1-8,10-11,13-14H/t10-,11+,13-,14-/m0/s1 |
| InChIKey | XALUWEUIIIWAGQ-XCCSTKFXSA-N |
| XLogP | 1.99 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|