C16H20O6S2 — CID 98163824
[(1S,4S,7S,10S)-9-(methylsulfonyloxymethyl)-8-pentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-dienyl]methyl methanesulfonate (PubChem CID 98163824) has the molecular formula C16H20O6S2 and a molecular weight of 372.46 g/mol. Its IUPAC name is [(1S,4S,7S,10S)-9-(methylsulfonyloxymethyl)-8-pentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-dienyl]methyl methanesulfonate.
| Compound Name | [(1S,4S,7S,10S)-9-(methylsulfonyloxymethyl)-8-pentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-dienyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 98163824 |
| Molecular Formula | C16H20O6S2 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | [(1S,4S,7S,10S)-9-(methylsulfonyloxymethyl)-8-pentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-dienyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC12[C@H]3C=C[C@H]4C3C3[C@@H]1C=C[C@@H]3C42COS(C)(=O)=O |
| InChI | InChI=1S/C16H20O6S2/c1-23(17,18)21-7-15-9-3-5-11-13(9)14-10(15)4-6-12(14)16(11,15)8-22-24(2,19)20/h3-6,9-14H,7-8H2,1-2H3/t9-,10-,11-,12-,13?,14?,15?,16?/m0/s1 |
| InChIKey | RDNAPKDRBHHBPZ-MPGXDKKDSA-N |
| XLogP | 0.79 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|