C23H18NO2+ — CID 10252655
(1R,8R)-16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene (PubChem CID 10252655) has the molecular formula C23H18NO2+ and a molecular weight of 340.40 g/mol. Its IUPAC name is (1R,8R)-16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene.
| Compound Name | (1R,8R)-16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 10252655 |
| Molecular Formula | C23H18NO2+ |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (1R,8R)-16,16-bis(furan-3-yl)-2-azoniatetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
| SMILES | c1ccc2c(c1)[C@H]1c3cccc[n+]3[C@@H]2CC1(c1ccoc1)c1ccoc1 |
| InChI | InChI=1S/C23H18NO2/c1-2-6-19-18(5-1)21-13-23(16-8-11-25-14-16,17-9-12-26-15-17)22(19)20-7-3-4-10-24(20)21/h1-12,14-15,21-22H,13H2/q+1/t21-,22+/m1/s1 |
| InChIKey | PRRZGMSIGMHVJD-YADHBBJMSA-N |
| XLogP | 4.58 |
| TPSA | 30.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|