C32H25ClN2O2 — CID 10323871
(1R,8R)-14,14-bis(furan-3-yl)-12-(naphthalen-1-ylmethyl)-12-aza-9-azoniatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9(13),10-pentaene chloride (PubChem CID 10323871) has the molecular formula C32H25ClN2O2 and a molecular weight of 505.02 g/mol. Its IUPAC name is (1R,8R)-14,14-bis(furan-3-yl)-12-(naphthalen-1-ylmethyl)-12-aza-9-azoniatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9(13),10-pentaene chloride.
| Compound Name | (1R,8R)-14,14-bis(furan-3-yl)-12-(naphthalen-1-ylmethyl)-12-aza-9-azoniatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9(13),10-pentaene chloride |
|---|---|
| PubChem CID | 10323871 |
| Molecular Formula | C32H25ClN2O2 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | (1R,8R)-14,14-bis(furan-3-yl)-12-(naphthalen-1-ylmethyl)-12-aza-9-azoniatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6,9(13),10-pentaene chloride |
| SMILES | [Cl-].c1ccc2c(c1)[C@H]1c3n(Cc4cccc5ccccc45)cc[n+]3[C@@H]2CC1(c1ccoc1)c1ccoc1 |
| InChI | InChI=1S/C32H25N2O2.ClH/c1-2-9-26-22(6-1)7-5-8-23(26)19-33-14-15-34-29-18-32(24-12-16-35-20-24,25-13-17-36-21-25)30(31(33)34)28-11-4-3-10-27(28)29;/h1-17,20-21,29-30H,18-19H2;1H/q+1;/p-1/t29-,30+;/m1./s1 |
| InChIKey | TWQAQFNNWJIWRT-GNSKLVJZSA-M |
| XLogP | 3.59 |
| TPSA | 35.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|