C16H24 — CID 159199814
methane;(1S,8R)-3,11,11-trimethyltricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (PubChem CID 159199814) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is methane;(1S,8R)-3,11,11-trimethyltricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene.
| Compound Name | methane;(1S,8R)-3,11,11-trimethyltricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 159199814 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | methane;(1S,8R)-3,11,11-trimethyltricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| SMILES | C.C.Cc1cccc2c1[C@H]1C=C[C@@H]2C1(C)C |
| InChI | InChI=1S/C14H16.2CH4/c1-9-5-4-6-10-11-7-8-12(13(9)10)14(11,2)3;;/h4-8,11-12H,1-3H3;2*1H4/t11-,12+;;/m0../s1 |
| InChIKey | KPDKFHMOMNSIPJ-UVDYRLMLSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|