C12H17O+ — CID 144945477
2,2,3,4-tetramethyl-3H-1-benzofuran-1-ium (PubChem CID 144945477) has the molecular formula C12H17O+ and a molecular weight of 177.27 g/mol. Its IUPAC name is 2,2,3,4-tetramethyl-3H-1-benzofuran-1-ium.
| Compound Name | 2,2,3,4-tetramethyl-3H-1-benzofuran-1-ium |
|---|---|
| PubChem CID | 144945477 |
| Molecular Formula | C12H17O+ |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2,2,3,4-tetramethyl-3H-1-benzofuran-1-ium |
| SMILES | Cc1cccc2c1C(C)C(C)(C)[OH+]2 |
| InChI | InChI=1S/C12H16O/c1-8-6-5-7-10-11(8)9(2)12(3,4)13-10/h5-7,9H,1-4H3/p+1 |
| InChIKey | BQSLMDWSFKZVKT-UHFFFAOYSA-O |
| XLogP | 3.13 |
| TPSA | 12.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|