C18H18O2 — CID 129387695
(1R,8R,15S,16S)-4,5-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-15,16-diol (PubChem CID 129387695) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R,8R,15S,16S)-4,5-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-15,16-diol.
| Compound Name | (1R,8R,15S,16S)-4,5-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-15,16-diol |
|---|---|
| PubChem CID | 129387695 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (1R,8R,15S,16S)-4,5-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene-15,16-diol |
| SMILES | Cc1cc2c(cc1C)[C@H]1c3ccccc3[C@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H18O2/c1-9-7-13-14(8-10(9)2)16-12-6-4-3-5-11(12)15(13)17(19)18(16)20/h3-8,15-20H,1-2H3/t15-,16-,17+,18+/m1/s1 |
| InChIKey | MKTIQGSWGWAWKH-BDXSIMOUSA-N |
| XLogP | 2.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |