C18H20O4 — CID 15429795
15,16-dimethyltricyclo[9.3.1.14,8]hexadeca-1(15),4(16),5,7,11,13-hexaene-2,3,9,10-tetrol (PubChem CID 15429795) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 15,16-dimethyltricyclo[9.3.1.14,8]hexadeca-1(15),4(16),5,7,11,13-hexaene-2,3,9,10-tetrol.
| Compound Name | 15,16-dimethyltricyclo[9.3.1.14,8]hexadeca-1(15),4(16),5,7,11,13-hexaene-2,3,9,10-tetrol |
|---|---|
| PubChem CID | 15429795 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 15,16-dimethyltricyclo[9.3.1.14,8]hexadeca-1(15),4(16),5,7,11,13-hexaene-2,3,9,10-tetrol |
| SMILES | Cc1c2cccc1C(O)C(O)c1cccc(c1C)C(O)C2O |
| InChI | InChI=1S/C18H20O4/c1-9-11-5-3-6-12(9)16(20)18(22)14-8-4-7-13(10(14)2)17(21)15(11)19/h3-8,15-22H,1-2H3 |
| InChIKey | LMSWAUCOFZIADV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |