C10H10O3 — CID 102427204
(1R,2S)-1,2-dihydronaphthalene-1,2,5-triol (PubChem CID 102427204) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is (1R,2S)-1,2-dihydronaphthalene-1,2,5-triol.
| Compound Name | (1R,2S)-1,2-dihydronaphthalene-1,2,5-triol |
|---|---|
| PubChem CID | 102427204 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (1R,2S)-1,2-dihydronaphthalene-1,2,5-triol |
| SMILES | Oc1cccc2c1C=C[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C10H10O3/c11-8-3-1-2-7-6(8)4-5-9(12)10(7)13/h1-5,9-13H/t9-,10+/m0/s1 |
| InChIKey | SGLWVPNWAVTUMD-VHSXEESVSA-N |
| XLogP | 0.81 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |