C12H10O2S — CID 102015309
(6R,7R)-6,7-dihydrobenzo[g][1]benzothiole-6,7-diol (PubChem CID 102015309) has the molecular formula C12H10O2S and a molecular weight of 218.28 g/mol. Its IUPAC name is (6R,7R)-6,7-dihydrobenzo[g][1]benzothiole-6,7-diol.
| Compound Name | (6R,7R)-6,7-dihydrobenzo[g][1]benzothiole-6,7-diol |
|---|---|
| PubChem CID | 102015309 |
| Molecular Formula | C12H10O2S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (6R,7R)-6,7-dihydrobenzo[g][1]benzothiole-6,7-diol |
| SMILES | O[C@@H]1C=Cc2c(ccc3ccsc23)[C@H]1O |
| InChI | InChI=1S/C12H10O2S/c13-10-4-3-9-8(11(10)14)2-1-7-5-6-15-12(7)9/h1-6,10-11,13-14H/t10-,11-/m1/s1 |
| InChIKey | ALGPRUOFHOBPMX-GHMZBOCLSA-N |
| XLogP | 2.32 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |