C13H14S2 — CID 145022999
ethane;2-methylthieno[3,2-g][1]benzothiole (PubChem CID 145022999) has the molecular formula C13H14S2 and a molecular weight of 234.39 g/mol. Its IUPAC name is ethane;2-methylthieno[3,2-g][1]benzothiole.
| Compound Name | ethane;2-methylthieno[3,2-g][1]benzothiole |
|---|---|
| PubChem CID | 145022999 |
| Molecular Formula | C13H14S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | ethane;2-methylthieno[3,2-g][1]benzothiole |
| SMILES | CC.Cc1cc2ccc3ccsc3c2s1 |
| InChI | InChI=1S/C11H8S2.C2H6/c1-7-6-9-3-2-8-4-5-12-10(8)11(9)13-7;1-2/h2-6H,1H3;1-2H3 |
| InChIKey | PTAHBUWVWFNZAJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |