About [1]benzothiolo[7,6-b][1]benzothiole
[1]benzothiolo[7,6-b][1]benzothiole (PubChem CID 13164288) has the molecular formula C14H8S2
and a molecular weight of 240.35 g/mol. Its IUPAC name is [1]benzothiolo[7,6-b][1]benzothiole.
Molecular Properties
| Compound Name | [1]benzothiolo[7,6-b][1]benzothiole |
| PubChem CID | 13164288 |
| Molecular Formula | C14H8S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | [1]benzothiolo[7,6-b][1]benzothiole |
| SMILES | c1ccc2c(c1)sc1c2ccc2ccsc21 |
| InChI | InChI=1S/C14H8S2/c1-2-4-12-10(3-1)11-6-5-9-7-8-15-13(9)14(11)16-12/h1-8H |
| InChIKey | GHBPPUPSUFNMPC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1]benzothiolo[7,6-b][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzothiolo[7,6-b][1]benzothiole?
The IUPAC name of [1]benzothiolo[7,6-b][1]benzothiole (CID 13164288) is [1]benzothiolo[7,6-b][1]benzothiole.
What is the SMILES notation for [1]benzothiolo[7,6-b][1]benzothiole?
The canonical SMILES for [1]benzothiolo[7,6-b][1]benzothiole is c1ccc2c(c1)sc1c2ccc2ccsc21.
What is the InChIKey of [1]benzothiolo[7,6-b][1]benzothiole?
The InChIKey is GHBPPUPSUFNMPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8S2/c1-2-4-12-10(3-1)11-6-5-9-7-8-15-13(9)14(11)16-12/h1-8H.
What are the key properties of [1]benzothiolo[7,6-b][1]benzothiole?
[1]benzothiolo[7,6-b][1]benzothiole has a molecular weight of 240.35 g/mol, XLogP of 5.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzothiolo[7,6-b][1]benzothiole is sourced from PubChem (CID 13164288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).