C10H5IS2 — CID 144775471
2-iodothieno[3,2-g][1]benzothiole (PubChem CID 144775471) has the molecular formula C10H5IS2 and a molecular weight of 316.19 g/mol. Its IUPAC name is 2-iodothieno[3,2-g][1]benzothiole.
| Compound Name | 2-iodothieno[3,2-g][1]benzothiole |
|---|---|
| PubChem CID | 144775471 |
| Molecular Formula | C10H5IS2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.89 |
| IUPAC Name | 2-iodothieno[3,2-g][1]benzothiole |
| SMILES | Ic1cc2ccc3ccsc3c2s1 |
| InChI | InChI=1S/C10H5IS2/c11-8-5-7-2-1-6-3-4-12-9(6)10(7)13-8/h1-5H |
| InChIKey | MCSINTVOHWYAJH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|