C9H6I2OS — CID 131215410
2,7-diiodo-6-methoxy-1-benzothiophene (PubChem CID 131215410) has the molecular formula C9H6I2OS and a molecular weight of 416.02 g/mol. Its IUPAC name is 2,7-diiodo-6-methoxy-1-benzothiophene.
| Compound Name | 2,7-diiodo-6-methoxy-1-benzothiophene |
|---|---|
| PubChem CID | 131215410 |
| Molecular Formula | C9H6I2OS |
| Molecular Weight | 416.02 g/mol |
| Exact Mass | 415.82 |
| IUPAC Name | 2,7-diiodo-6-methoxy-1-benzothiophene |
| SMILES | COc1ccc2cc(I)sc2c1I |
| InChI | InChI=1S/C9H6I2OS/c1-12-6-3-2-5-4-7(10)13-9(5)8(6)11/h2-4H,1H3 |
| InChIKey | IECYQNZDZJZXCL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.02 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|