C36H26S4 — CID 145347991
dibenzothiophene;9,10-dimethylphenanthrene;3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 145347991) has the molecular formula C36H26S4 and a molecular weight of 586.87 g/mol. Its IUPAC name is dibenzothiophene;9,10-dimethylphenanthrene;3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | dibenzothiophene;9,10-dimethylphenanthrene;3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 145347991 |
| Molecular Formula | C36H26S4 |
| Molecular Weight | 586.87 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | dibenzothiophene;9,10-dimethylphenanthrene;3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | Cc1c(C)c2ccccc2c2ccccc12.c1cc2sc3ccsc3c2s1.c1ccc2c(c1)sc1ccccc12 |
| InChI | InChI=1S/C16H14.C12H8S.C8H4S3/c1-11-12(2)14-8-4-6-10-16(14)15-9-5-3-7-13(11)15;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-3-9-7-5(1)11-6-2-4-10-8(6)7/h3-10H,1-2H3;1-8H;1-4H |
| InChIKey | MLLIGTVVIGKELV-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.87 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|