C12H8O2S — CID 14176043
1-methyl-[1]benzothiolo[2,3-c]pyran-3-one (PubChem CID 14176043) has the molecular formula C12H8O2S and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-methyl-[1]benzothiolo[2,3-c]pyran-3-one.
| Compound Name | 1-methyl-[1]benzothiolo[2,3-c]pyran-3-one |
|---|---|
| PubChem CID | 14176043 |
| Molecular Formula | C12H8O2S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 1-methyl-[1]benzothiolo[2,3-c]pyran-3-one |
| SMILES | Cc1oc(=O)cc2c1sc1ccccc12 |
| InChI | InChI=1S/C12H8O2S/c1-7-12-9(6-11(13)14-7)8-4-2-3-5-10(8)15-12/h2-6H,1H3 |
| InChIKey | ZCSGNTOMLKJTBG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |