C14H7Cl3OS — CID 151134507
1,3,4-trichloro-2-methylthioxanthen-9-one (PubChem CID 151134507) has the molecular formula C14H7Cl3OS and a molecular weight of 329.64 g/mol. Its IUPAC name is 1,3,4-trichloro-2-methylthioxanthen-9-one.
| Compound Name | 1,3,4-trichloro-2-methylthioxanthen-9-one |
|---|---|
| PubChem CID | 151134507 |
| Molecular Formula | C14H7Cl3OS |
| Molecular Weight | 329.64 g/mol |
| Exact Mass | 327.93 |
| IUPAC Name | 1,3,4-trichloro-2-methylthioxanthen-9-one |
| SMILES | Cc1c(Cl)c(Cl)c2sc3ccccc3c(=O)c2c1Cl |
| InChI | InChI=1S/C14H7Cl3OS/c1-6-10(15)9-13(18)7-4-2-3-5-8(7)19-14(9)12(17)11(6)16/h2-5H,1H3 |
| InChIKey | MUXUVYWZWUBNEK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|