C20H22O3S — CID 167338730
2-(4-hydroxybutoxy)-1,3,4-trimethylthioxanthen-9-one (PubChem CID 167338730) has the molecular formula C20H22O3S and a molecular weight of 342.46 g/mol. Its IUPAC name is 2-(4-hydroxybutoxy)-1,3,4-trimethylthioxanthen-9-one.
| Compound Name | 2-(4-hydroxybutoxy)-1,3,4-trimethylthioxanthen-9-one |
|---|---|
| PubChem CID | 167338730 |
| Molecular Formula | C20H22O3S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-(4-hydroxybutoxy)-1,3,4-trimethylthioxanthen-9-one |
| SMILES | Cc1c(OCCCCO)c(C)c2c(=O)c3ccccc3sc2c1C |
| InChI | InChI=1S/C20H22O3S/c1-12-13(2)20-17(14(3)19(12)23-11-7-6-10-21)18(22)15-8-4-5-9-16(15)24-20/h4-5,8-9,21H,6-7,10-11H2,1-3H3 |
| InChIKey | DVFHRGSEHUFFPH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|