C23H22O5S — CID 167351239
(1,4-dimethyl-9-oxothioxanthen-2-yl) 5-prop-2-enoyloxypentanoate (PubChem CID 167351239) has the molecular formula C23H22O5S and a molecular weight of 410.49 g/mol. Its IUPAC name is (1,4-dimethyl-9-oxothioxanthen-2-yl) 5-prop-2-enoyloxypentanoate.
| Compound Name | (1,4-dimethyl-9-oxothioxanthen-2-yl) 5-prop-2-enoyloxypentanoate |
|---|---|
| PubChem CID | 167351239 |
| Molecular Formula | C23H22O5S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (1,4-dimethyl-9-oxothioxanthen-2-yl) 5-prop-2-enoyloxypentanoate |
| SMILES | C=CC(=O)OCCCCC(=O)Oc1cc(C)c2sc3ccccc3c(=O)c2c1C |
| InChI | InChI=1S/C23H22O5S/c1-4-19(24)27-12-8-7-11-20(25)28-17-13-14(2)23-21(15(17)3)22(26)16-9-5-6-10-18(16)29-23/h4-6,9-10,13H,1,7-8,11-12H2,2-3H3 |
| InChIKey | NIGIHOWRFHAINK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|