C23H22O6S — CID 177308252
5-[2-(9-oxothioxanthen-1-yl)oxyacetyl]oxypentan-2-yl prop-2-enoate (PubChem CID 177308252) has the molecular formula C23H22O6S and a molecular weight of 426.49 g/mol. Its IUPAC name is 5-[2-(9-oxothioxanthen-1-yl)oxyacetyl]oxypentan-2-yl prop-2-enoate.
| Compound Name | 5-[2-(9-oxothioxanthen-1-yl)oxyacetyl]oxypentan-2-yl prop-2-enoate |
|---|---|
| PubChem CID | 177308252 |
| Molecular Formula | C23H22O6S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 5-[2-(9-oxothioxanthen-1-yl)oxyacetyl]oxypentan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CCCOC(=O)COc1cccc2sc3ccccc3c(=O)c12 |
| InChI | InChI=1S/C23H22O6S/c1-3-20(24)29-15(2)8-7-13-27-21(25)14-28-17-10-6-12-19-22(17)23(26)16-9-4-5-11-18(16)30-19/h3-6,9-12,15H,1,7-8,13-14H2,2H3 |
| InChIKey | JBWYKXIIQVTWEG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|