C24H24O7S — CID 58325531
[2-hydroxy-3-(4-prop-2-enoyloxybutoxy)propyl] 9-oxothioxanthene-1-carboxylate (PubChem CID 58325531) has the molecular formula C24H24O7S and a molecular weight of 456.52 g/mol. Its IUPAC name is [2-hydroxy-3-(4-prop-2-enoyloxybutoxy)propyl] 9-oxothioxanthene-1-carboxylate.
| Compound Name | [2-hydroxy-3-(4-prop-2-enoyloxybutoxy)propyl] 9-oxothioxanthene-1-carboxylate |
|---|---|
| PubChem CID | 58325531 |
| Molecular Formula | C24H24O7S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | [2-hydroxy-3-(4-prop-2-enoyloxybutoxy)propyl] 9-oxothioxanthene-1-carboxylate |
| SMILES | C=CC(=O)OCCCCOCC(O)COC(=O)c1cccc2sc3ccccc3c(=O)c12 |
| InChI | InChI=1S/C24H24O7S/c1-2-21(26)30-13-6-5-12-29-14-16(25)15-31-24(28)18-9-7-11-20-22(18)23(27)17-8-3-4-10-19(17)32-20/h2-4,7-11,16,25H,1,5-6,12-15H2 |
| InChIKey | PSKRVMFAIGBSKU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|