C25H28O8 — CID 58385532
4-[3-[2-(4-benzoylphenoxy)acetyl]oxy-2-hydroxypropoxy]butyl prop-2-enoate (PubChem CID 58385532) has the molecular formula C25H28O8 and a molecular weight of 456.49 g/mol. Its IUPAC name is 4-[3-[2-(4-benzoylphenoxy)acetyl]oxy-2-hydroxypropoxy]butyl prop-2-enoate.
| Compound Name | 4-[3-[2-(4-benzoylphenoxy)acetyl]oxy-2-hydroxypropoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 58385532 |
| Molecular Formula | C25H28O8 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 4-[3-[2-(4-benzoylphenoxy)acetyl]oxy-2-hydroxypropoxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOCC(O)COC(=O)COc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H28O8/c1-2-23(27)31-15-7-6-14-30-16-21(26)17-33-24(28)18-32-22-12-10-20(11-13-22)25(29)19-8-4-3-5-9-19/h2-5,8-13,21,26H,1,6-7,14-18H2 |
| InChIKey | UOIMZHZOCRIHJI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|